On Target ACE2_HUMAN 0.27272728/CHEMBL251804
For the given ligand Phylattrin, we have found in our database that, being scored 0.27272728, the most similar ligand is CHEMBL251804. Check out the elaboration below.
| Phylattrin (Given Ligand) | CHEMBL251804 (Similar Ligand) |
|---|---|
| COc3cc2[oH+]c1c(O)cc(C/C=C(C)\C)c(OC)c1c(=O)c2c(C)c3C/C=C(C)/C | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1Oc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00000001 42000c08 20000109 00018202 00001001 00828000 42040401 01000600 80040004 00980a40 08000000 40008a00 0000c022 00200000 01000001 2808a008 00000000 02100004 00082000 00020a00 00400000 08020300 0000c028 06420014 00200000 e8000000 005a0800 40a00000 02000380 00020002 87020400 02000400 | 00010000 01005008 20100108 00118600 00001080 00000000 86000000 20000204 00000884 020a08c0 08300000 4001b0c0 06008002 00040000 81080001 00082008 90000000 02000000 00402008 00020201 00400100 18200e00 03000140 85500418 00000800 c0000000 00000000 10200040 04000300 00070003 20024400 03012600 |