On Target PR_FCoV 0.15841584/CHEMBL4214471
For the given ligand Phylattrin, we have found in our database that, being scored 0.15841584, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| Phylattrin (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| COc3cc2[oH+]c1c(O)cc(C/C=C(C)\C)c(OC)c1c(=O)c2c(C)c3C/C=C(C)/C | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000001 42000c08 20000109 00018202 00001001 00828000 42040401 01000600 80040004 00980a40 08000000 40008a00 0000c022 00200000 01000001 2808a008 00000000 02100004 00082000 00020a00 00400000 08020300 0000c028 06420014 00200000 e8000000 005a0800 40a00000 02000380 00020002 87020400 02000400 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |