On Target NP_HCoV-OC43 0.1875/CHEMBL3233481
For the given ligand Erlotinib, we have found in our database that, being scored 0.1875, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Erlotinib (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C#Cc3cccc(Nc1ncnc2cc(OCCOC)c(OCCOC)cc12)c3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04000002 00004008 20000908 08290600 00443000 00004000 06088010 00000808 00002100 00000850 01300004 40009800 04804027 00400000 01200041 020c800c 00040000 12004008 0860000a 10260400 41000000 08040028 24804040 0a400000 00042004 80000000 02040000 00800080 00408208 00460008 40000000 002001c0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |