On Target NA_A-H3N8 0.24905661/CHEMBL4288395
For the given ligand Sunitinib, we have found in our database that, being scored 0.24905661, the most similar ligand is CHEMBL4288395. Check out the elaboration below.
| Sunitinib (Given Ligand) | CHEMBL4288395 (Similar Ligand) |
|---|---|
| CCN(CC)CCNC(=O)c3c(C)[nH]c(C=c1c(=O)[nH]c2ccc(F)cc12)c3C | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(-c3ccc(SC)cc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 10084202 0080b800 00100180 16010e10 21000021 04008010 90204080 0802540c 01800100 28492850 09280104 70009008 01008002 0031b002 c00205c2 0844000c 24060408 12000104 08218000 00a00000 c1120000 38308e00 20822800 8341011d 00044004 c2000201 88406010 c0011281 0c60c104 00268003 a400a200 a0000620 | 00072040 09807200 00120100 84110700 00180080 00000800 02080180 3a00140e 11000100 001108c8 40200000 61019001 8402881a 01892000 00001408 00081008 14a24000 02000060 64c12010 10000201 80000020 38048e80 13808080 02500019 10001401 c0001400 00c04000 90000041 0c004300 00060401 24060000 00810a30 |