On Target PA_INFA 0.21719457/CHEMBL4452525
For the given ligand Carnosine, we have found in our database that, being scored 0.21719457, the most similar ligand is CHEMBL4452525. Check out the elaboration below.
| Carnosine (Given Ligand) | CHEMBL4452525 (Similar Ligand) |
|---|---|
| NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O | COCCN1C[C@H](C(c2ccccc2)c2ccccc2)n2cc(Cl)c(=O)c(O)c2C1=O |
|
|
|
|
|
|
| 04000002 00005400 00100000 01800410 040000c0 00000000 00002000 0000000c 00400980 00090300 20208000 50013800 0e008002 00100800 810a0000 000c000c 10000000 0e000000 00400018 40000201 00000c00 10200e00 230000c0 10000018 00041001 00000200 00000000 00000000 04000004 00460011 60004000 20002200 | 0001801a 00007e08 70104100 50010e00 000400a8 00120044 0d000000 23203401 02300800 801908c0 08398004 40018800 0600984e 00500006 001a1c00 020c210c 10004000 02004002 00200008 00060201 40000101 382f8710 32802000 c350001c 0811ec00 e0000280 00c40060 d0040001 0c040384 0406001b a40c0000 40024600 |