On Target NA_A-H3N8 0.14893617/CHEMBL4278505
For the given ligand Policresulen, we have found in our database that, being scored 0.14893617, the most similar ligand is CHEMBL4278505. Check out the elaboration below.
| Policresulen (Given Ligand) | CHEMBL4278505 (Similar Ligand) |
|---|---|
| Cc1cc(O)c(S(=O)(=O)O)cc1Cc3cc(S(=O)(=O)O)c(O)c(Cc2cc(S(=O)(=O)O)c(O)cc2C)c3C | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(Cc3ccccc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000000 40801008 20002102 00d10200 00000101 00010000 02000400 01000200 04800800 00080840 08002000 60008200 00000002 00200002 80200280 00082008 00000200 02000000 00008000 00022200 80000000 08000000 00004028 08400018 00008000 a0000000 00120000 40800020 02000080 00020002 02000000 00010420 | 00070040 09007000 00100100 84010700 00180080 00000800 02080180 3b00140a 11000100 001908c8 48200000 41019801 8402881a 01882000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000020 38048e80 13008080 02500018 10001401 e0001400 00c04000 d0000001 0c000380 00060403 24060000 00800e10 |