On Target GP_EBOV 0.28440368/CHEMBL4640931
For the given ligand erastin, we have found in our database that, being scored 0.28440368, the most similar ligand is CHEMBL4640931. Check out the elaboration below.
| erastin (Given Ligand) | CHEMBL4640931 (Similar Ligand) |
|---|---|
| CCOc1ccccc1N3CC(=O)c2ccccc2/N=C3/C(C)N5CCN(C(=O)COc4ccc(Cl)cc4)CC5 | CC(c1ccc(C(=O)N2CCc3cc(C(C)(C)C)ccc32)cc1)N1CCCCC1 |
|
|
|
|
|
|
| 0400e042 00002818 20104128 04010622 a0001088 00210000 121c0050 01420008 000002c0 00080a43 1a270004 4400ea20 12809006 40002009 811210c1 00184008 10048800 82000420 09000010 00420200 50122000 38270700 b2402023 8342881f 00893000 88100080 60900408 00000881 0c089290 00862003 80005c01 24022700 | 00004002 01001800 00100100 40010600 20001001 00000040 00000000 22001004 00000180 000808c0 08280024 5001c800 80008802 00108000 00020540 00080008 00048000 02000000 08000000 00000201 40100000 18228600 20012000 8154001d 00000000 c0000000 00000010 90801080 04088100 00060003 a0040000 20000600 |