On Target PLP_SARS 0.2555066/CHEMBL225515
For the given ligand erastin, we have found in our database that, being scored 0.2555066, the most similar ligand is CHEMBL225515. Check out the elaboration below.
| erastin (Given Ligand) | CHEMBL225515 (Similar Ligand) |
|---|---|
| CCOc1ccccc1n5c(C(C)N3CCN(C(=O)COc2ccc(Cl)cc2)CC3)nc4ccccc4c5=O | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2[nH]1 |
|
|
|
|
|
|
| 0400a00a 00002208 20400008 14300e12 800c10e0 00104120 02009802 0000b009 06100100 400008e0 0125800c 4081c800 0280b806 00602200 011610c1 020c410c 18000018 80008402 00600000 00020000 600000c1 38078738 33800061 83300418 00102000 c0080040 20108008 00040001 0c004304 00460009 40640000 e01266a2 | 04008002 00000808 62024108 10010200 00041020 04004044 80080000 01200000 00000300 00000840 00080004 40048800 0680880c 08510002 01030042 020c000c 04028000 02802004 00200008 00020000 40000000 08068b68 b0802002 80c09104 00002c00 80182200 00000200 00000000 00000204 00020001 c0040200 10020000 |