On Target RT_HIV1 0.29969418/CHEMBL3957860
For the given ligand erastin, we have found in our database that, being scored 0.29969418, the most similar ligand is CHEMBL3957860. Check out the elaboration below.
| erastin (Given Ligand) | CHEMBL3957860 (Similar Ligand) |
|---|---|
| CCOc1ccccc1n5c(C(C)N3CCN(C(=O)COc2ccc(Cl)cc2)CC3)nc4ccccc4c5=O | COC(=O)N[C@H](C(=O)NCc1ccc(C(CO)N(Cc2cc3cccnc3[nH]2)S(=O)(=O)c2ccc3scnc3c2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0400a00a 00002208 20400008 14300e12 800c10e0 00104120 02009802 0000b009 06100100 400008e0 0125800c 4081c800 0280b806 00602200 011610c1 020c410c 18000018 80008402 00600000 00020000 600000c1 38078738 33800061 83300418 00102000 c0080040 20108008 00040001 0c004304 00460009 40640000 e01266a2 | 0003005a 1180b200 03184108 15b10e01 100c00e0 0013c000 04010081 2b00f00f 00c60b40 004938c0 09b12a04 f000b880 8e008832 00d02021 b02624c0 021e070c 18423010 0219208e 82700018 0000620d e0001900 78298eb0 23900000 db410158 42100800 ec010406 40300800 d000202c 0c600784 2046000f e0044200 00c147e0 |