On Target PR_FCoV 0.19685039/CHEMBL4214471
For the given ligand erastin, we have found in our database that, being scored 0.19685039, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| erastin (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| CCOc1ccccc1n5c(C(C)N3CCN(C(=O)COc2ccc(Cl)cc2)CC3)nc4ccccc4c5=O | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0400a00a 00002208 20400008 14300e12 800c10e0 00104120 02009802 0000b009 06100100 400008e0 0125800c 4081c800 0280b806 00602200 011610c1 020c410c 18000018 80008402 00600000 00020000 600000c1 38078738 33800061 83300418 00102000 c0080040 20108008 00040001 0c004304 00460009 40640000 e01266a2 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |