On Target GP_EBOV 0.3006135/CHEMBL3125897
For the given ligand Boceprevir, we have found in our database that, being scored 0.3006135, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| Boceprevir (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]3[C@@H]([C@H]1C(=O)NC(CC2CCC2)C(=O)C(N)=O)C3(C)C)C(C)(C)C | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00010000 01003400 00100000 04000c00 00000000 00000010 00000004 20002008 04000000 00020180 00200000 50013000 0e00b01a 01002011 80000000 00000000 00000010 00000001 00002050 00000201 00000100 300d0630 00000003 02100018 00011000 00000000 00000000 10000000 08000000 00040011 20024000 00002200 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |