On Target NS5B_HCV1B 0.3962264/CHEMBL3645183
For the given ligand sultam1, we have found in our database that, being scored 0.3962264, the most similar ligand is CHEMBL3645183. Check out the elaboration below.
| sultam1 (Given Ligand) | CHEMBL3645183 (Similar Ligand) |
|---|---|
| O=C2CCS(=O)(=O)N(Cc1ccccc1)c3ccccc23 | CCN(c1cc2nn(-c3ccc(NCC(C)C)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 10804002 25000800 00080902 01310600 80000000 00018042 00020001 02001000 00800800 00081840 08302404 4000d000 00008c02 00040001 800a0040 00020000 00068020 02100000 08204008 00404801 60100120 88828a01 20010100 00440034 06200480 80004000 40000000 8000108c 00088100 00060012 80040880 21010760 | 00004006 00805e08 20180902 41390e00 210c0000 00004042 02040000 0200140c 00100900 000908c0 09312024 40118800 80008c23 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0100101 1c878e38 20800800 8360001c 02104080 c0000040 00270080 8000108c 0c488104 0046004b c4048080 a01147e0 |