On Target NS5B_HCV1A 0.33620688/CHEMBL3644912
For the given ligand sultam1, we have found in our database that, being scored 0.33620688, the most similar ligand is CHEMBL3644912. Check out the elaboration below.
| sultam1 (Given Ligand) | CHEMBL3644912 (Similar Ligand) |
|---|---|
| O=C2CCS(=O)(=O)N(Cc1ccccc1)c3ccccc23 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(C3CCCCC3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 10804002 25000800 00080902 01310600 80000000 00018042 00020001 02001000 00800800 00081840 08302404 4000d000 00008c02 00040001 800a0040 00020000 00068020 02100000 08204008 00404801 60100120 88828a01 20010100 00440034 06200480 80004000 40000000 8000108c 00088100 00060012 80040880 21010760 | 00014086 0d403c00 00100122 45310f00 20080000 00018000 000a0004 a0003409 10800a00 005a8be8 08302404 5001b000 0e00f002 0124a101 80420440 001a8008 02864010 02482000 4a612850 00004a01 60100100 bc050e10 21020003 3244003a 02112000 80001002 00000000 902000ac 08008202 81060093 a41a4000 01016670 |