On Target RT_HIV1 0.2947977/CHEMBL4227382
For the given ligand sultam1, we have found in our database that, being scored 0.2947977, the most similar ligand is CHEMBL4227382. Check out the elaboration below.
| sultam1 (Given Ligand) | CHEMBL4227382 (Similar Ligand) |
|---|---|
| O=C2CCS(=O)(=O)N(Cc1ccccc1)c3ccccc23 | C=C(C)[C@@H]1CC[C@]2(CNCCCN(C)c3ccccc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 10804002 25000800 00080902 01310600 80000000 00018042 00020001 02001000 00800800 00081840 08302404 4000d000 00008c02 00040001 800a0040 00020000 00068020 02100000 08204008 00404801 60100120 88828a01 20010100 00440034 06200480 80004000 40000000 8000108c 00088100 00060012 80040880 21010760 | 00004002 01000c00 00100302 40050600 20000000 00004000 80000080 20000402 00000900 001809e0 08300004 40018800 00028002 00200000 00020442 00080008 00040400 02000020 0a012000 00000201 61100100 18020a30 20008020 00500014 01200000 80000000 00406000 d0000080 00408002 01060012 e4020000 00002600 |