On Target GP_EBOV 0.35403726/CHEMBL4640931
For the given ligand sultam1, we have found in our database that, being scored 0.35403726, the most similar ligand is CHEMBL4640931. Check out the elaboration below.
| sultam1 (Given Ligand) | CHEMBL4640931 (Similar Ligand) |
|---|---|
| O=C2CCS(=O)(=O)N(Cc1ccccc1)c3ccccc23 | CC(c1ccc(C(=O)N2CCc3cc(C(C)(C)C)ccc32)cc1)N1CCCCC1 |
|
|
|
|
|
|
| 10804002 25000800 00080902 01310600 80000000 00018042 00020001 02001000 00800800 00081840 08302404 4000d000 00008c02 00040001 800a0040 00020000 00068020 02100000 08204008 00404801 60100120 88828a01 20010100 00440034 06200480 80004000 40000000 8000108c 00088100 00060012 80040880 21010760 | 00004002 01001800 00100100 40010600 20001001 00000040 00000000 22001004 00000180 000808c0 08280024 5001c800 80008802 00108000 00020540 00080008 00048000 02000000 08000000 00000201 40100000 18228600 20012000 8154001d 00000000 c0000000 00000010 90801080 04088100 00060003 a0040000 20000600 |