On Target DPM_HHV1K 0.18959108/CHEMBL479371
For the given ligand sultam1, we have found in our database that, being scored 0.18959108, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| sultam1 (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| O=C2CCS(=O)(=O)N(Cc1ccccc1)c3ccccc23 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 10804002 25000800 00080902 01310600 80000000 00018042 00020001 02001000 00800800 00081840 08302404 4000d000 00008c02 00040001 800a0040 00020000 00068020 02100000 08204008 00404801 60100120 88828a01 20010100 00440034 06200480 80004000 40000000 8000108c 00088100 00060012 80040880 21010760 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |