On Target NS3_HCV1B 0.29803923/CHEMBL1170408
For the given ligand sultam1, we have found in our database that, being scored 0.29803923, the most similar ligand is CHEMBL1170408. Check out the elaboration below.
| sultam1 (Given Ligand) | CHEMBL1170408 (Similar Ligand) |
|---|---|
| O=C2CCS(=O)(=O)N(Cc1ccccc1)c3ccccc23 | C=CCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 10804002 25000800 00080902 01310600 80000000 00018042 00020001 02001000 00800800 00081840 08302404 4000d000 00008c02 00040001 800a0040 00020000 00068020 02100000 08204008 00404801 60100120 88828a01 20010100 00440034 06200480 80004000 40000000 8000108c 00088100 00060012 80040880 21010760 | 08012082 65c03008 20184108 15310600 00241021 00018000 96060080 22081408 20800284 105988c0 08202404 4011b000 0f00c802 00442001 c1420441 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |