On Target ACE2_HUMAN 0.25/CHEMBL402987
For the given ligand sultam1, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL402987. Check out the elaboration below.
| sultam1 (Given Ligand) | CHEMBL402987 (Similar Ligand) |
|---|---|
| O=C2CCS(=O)(=O)N(Cc1ccccc1)c3ccccc23 | O=C(N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O)[C@@H](S)CCc1ccccc1 |
|
|
|
|
|
|
| 10804002 25000800 00080902 01310600 80000000 00018042 00020001 02001000 00800800 00081840 08302404 4000d000 00008c02 00040001 800a0040 00020000 00068020 02100000 08204008 00404801 60100120 88828a01 20010100 00440034 06200480 80004000 40000000 8000108c 00088100 00060012 80040880 21010760 | 00012000 01005000 00100102 00110600 00000080 00000000 80000000 20000004 00100980 020a08c0 08300000 4001b800 06008002 00240000 80080000 00080008 10020000 02000000 04400008 10000201 20000100 18200e00 13000140 85500018 00000800 80000000 00000000 10000040 04004000 00060013 20004000 03412600 |