On Target E2_HCV77 0.2724719/CHEMBL3975185
For the given ligand JJ001, we have found in our database that, being scored 0.2724719, the most similar ligand is CHEMBL3975185. Check out the elaboration below.
| JJ001 (Given Ligand) | CHEMBL3975185 (Similar Ligand) |
|---|---|
| O=C3/C(=C/c1ccccc1)S(=O)(=O)N(Cc2ccccc2)c4ccccc34 | CNC(=O)c1c(C2=CCCC2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4c(n3)-c3cc5ccccc5n3CO4)cc12 |
|
|
|
|
|
|
| 10804802 04000800 00080b02 41310602 80022081 00812942 80020081 02401400 01850010 01b91840 48302404 4008c000 0000cc80 00040001 880a0042 00028000 10868420 22109000 08218000 00014801 40100000 88028a00 24118000 0a440034 03200080 80004000 40412000 c02010cc 00488100 00060382 84048081 21010760 | 1049620a 01200828 e2084b0a 50310e02 0a041261 0200890c 80ad0490 62283640 04874940 f01808d0 cc31a124 40358c90 c20a8c95 08680081 c12a5862 221e200c 00264400 12032004 0e242000 14424227 405e0500 3a078e5e f180c020 8058c016 0900249c c0214203 34427654 d88410cc 0040e32e 11a60443 c4145a00 40010660 |