On Target ACE2_HUMAN 0.18957347/CHEMBL350414
For the given ligand JJ001, we have found in our database that, being scored 0.18957347, the most similar ligand is CHEMBL350414. Check out the elaboration below.
| JJ001 (Given Ligand) | CHEMBL350414 (Similar Ligand) |
|---|---|
| O=C3/C(=C/c1ccccc1)S(=O)(=O)N(Cc2ccccc2)c4ccccc34 | O=C(N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O)[C@@H](S)Cc1ccccc1 |
|
|
|
|
|
|
| 10804802 04000800 00080b02 41310602 80022081 00812942 80020081 02401400 01850010 01b91840 48302404 4008c000 0000cc80 00040001 880a0042 00028000 10868420 22109000 08218000 00014801 40100000 88028a00 24118000 0a440034 03200080 80004000 40412000 c02010cc 00488100 00060382 84048081 21010760 | 00002000 00005200 00100100 00110600 00000080 00000000 80000000 20000004 00000980 030b08c0 08300000 4000b800 06008002 00040000 80080000 000c0008 10020000 02000000 04400008 10000201 00000100 18200e00 13000040 87400018 00000800 80000000 00000000 10000040 04004000 0006000b 20004000 03012600 |