On Target PR_SARS 0.16129032/CHEMBL3105073
For the given ligand JJJ002, we have found in our database that, being scored 0.16129032, the most similar ligand is CHEMBL3105073. Check out the elaboration below.
| JJJ002 (Given Ligand) | CHEMBL3105073 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)N(Cc2ccccc2)c3ccccc3 | S=C(NCc1cccnc1)SCc1cc(Cl)sc1Cl |
|
|
|
|
|
|
| 00004006 00800000 00000100 00010e40 00000000 00000000 00000004 02003001 00000000 00000840 01280004 4000c000 00008800 00100000 00000040 00000000 00044000 02400000 08000000 00000000 c0100100 08018400 20032000 00400008 00100000 80000000 00000000 80000080 00008100 00060001 00040000 80004200 | 10018012 00008008 10006d00 01100610 20149004 00404084 04024000 22001000 00000001 03404040 01200204 40200880 0200180c 000c0001 80001000 00040104 04000400 02000304 00200000 01040208 40100000 48008981 20880020 02400000 05040000 04000200 28000400 a0020404 03603100 00060000 00000011 81c30288 |