On Target NS5B_HCV1B 0.25668448/CHEMBL3645183
For the given ligand JJJ002, we have found in our database that, being scored 0.25668448, the most similar ligand is CHEMBL3645183. Check out the elaboration below.
| JJJ002 (Given Ligand) | CHEMBL3645183 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)N(Cc2ccccc2)c3ccccc3 | CCN(c1cc2nn(-c3ccc(NCC(C)C)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00004006 00800000 00000100 00010e40 00000000 00000000 00000004 02003001 00000000 00000840 01280004 4000c000 00008800 00100000 00000040 00000000 00044000 02400000 08000000 00000000 c0100100 08018400 20032000 00400008 00100000 80000000 00000000 80000080 00008100 00060001 00040000 80004200 | 00004006 00805e08 20180902 41390e00 210c0000 00004042 02040000 0200140c 00100900 000908c0 09312024 40118800 80008c23 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0100101 1c878e38 20800800 8360001c 02104080 c0000040 00270080 8000108c 0c488104 0046004b c4048080 a01147e0 |