On Target NA_INFB 0.12738854/CHEMBL4161935
For the given ligand jj, we have found in our database that, being scored 0.12738854, the most similar ligand is CHEMBL4161935. Check out the elaboration below.
| jj (Given Ligand) | CHEMBL4161935 (Similar Ligand) |
|---|---|
| CN(C(=O)Nc1ccccc1)c2ccccc2 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N(CC)CC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000006 00000000 00000000 00000a40 00000000 00000000 00000000 00002001 00000000 00000840 00280004 00008000 00008000 00100000 00000040 00000000 00040000 00000000 08000000 00000000 40000100 08000400 20022000 00000000 00100000 00000000 00000000 00000080 00008000 00060001 00000000 00004000 | 00074042 09007800 00100100 84010700 00180080 00000800 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00001448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |