On Target NS5B_HCV1B 0.20746888/CHEMBL3422106
For the given ligand Nirmatrelvir, we have found in our database that, being scored 0.20746888, the most similar ligand is CHEMBL3422106. Check out the elaboration below.
| Nirmatrelvir (Given Ligand) | CHEMBL3422106 (Similar Ligand) |
|---|---|
| CC(C)(C)C(NC(=O)C(F)(F)F)C(=O)N1CC3C(C1C(=O)NC(C#N)CC2CCNC2=O)C3(C)C | CC(C)N1CCC(N(C)C(=O)Cn2c(-c3ccccc3)c(C3CCCCC3)c3sc(C(=O)O)cc32)C1 |
|
|
|
|
|
|
| 00030000 01003000 00100000 04000400 00000000 000000d0 10000000 20000008 00200000 80000080 00200000 50033000 0600801a 01402001 80000000 00080008 00400000 00000000 00002000 00000205 00000000 30040630 03000403 02300018 00000000 00000000 00000100 90000000 08000000 00040001 20004000 00802380 | 000360c2 2d003c01 00100912 55810618 201e5121 0000c110 00002080 2009400c 20600900 100809e0 08300a04 4003a080 8800881a 00e0b801 204a3d20 0c0c000c 11134000 c280209c 06202400 00514213 00102100 788e8ef0 30904083 9250001e 0a842001 c4000009 08010000 90000044 0a044c06 00061453 c0020a40 00c11e20 |