On Target PLP_SARS 0.22680412/CHEMBL358279
For the given ligand Galidesivir, we have found in our database that, being scored 0.22680412, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Galidesivir (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| Nc2ncnc3c([C@@H]1N[C@H](CO)[C@@H](O)[C@H]1O)c[nH]c23 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 1000000a 0180c800 00100102 c8880630 002c01c0 0000c010 0000e000 02001800 00500900 000800c0 61300004 40011000 08000802 01a00800 002c0440 000c000c 18020008 02000004 01e02400 40200201 40000100 18008860 278000c0 00400010 00046001 c0000000 08008080 80000004 0040010a 00460002 60008200 800006e0 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |