On Target NS5B_HCV1B 0.45173746/CHEMBL4111989
For the given ligand Galidesivir triphosphate form, we have found in our database that, being scored 0.45173746, the most similar ligand is CHEMBL4111989. Check out the elaboration below.
| Galidesivir triphosphate form (Given Ligand) | CHEMBL4111989 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O)c[nH]c23 | C[C@@]1(C#N)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1c1ccc2c(N)ncnn12 |
|
|
|
|
|
|
| 1000080a 0180c800 20500502 c8880e30 002c01c4 0012c030 0080e000 02001880 00500900 000800c0 61300004 48011000 08000802 01a20820 002e0440 000c060c 190e00a8 02000006 01e02400 40203203 40000100 1c008860 278000c0 00400010 40046001 c0000100 0a008080 80050004 0040010a 00460016 61408280 c000a6e2 | 0000080a 81004009 e2401512 19010f20 050c8074 0012c024 0381c000 00200a80 1040cb00 010c0040 08108004 4a839040 00000802 02b30020 000e0040 020cba0c 094b8820 0680000e 01602008 00665203 40100121 2c008860 a5801cc6 08600110 40000400 80002102 060880c0 800508a0 0040020e 00c6cc16 41400280 6220ac82 |