On Target RT_HIV1 0.31612903/CHEMBL3937869
For the given ligand Galidesivir triphosphate form, we have found in our database that, being scored 0.31612903, the most similar ligand is CHEMBL3937869. Check out the elaboration below.
| Galidesivir triphosphate form (Given Ligand) | CHEMBL3937869 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O)c[nH]c23 | CC(C)CN(C(CO)c1ccc(CNC(=O)C(NC(=O)c2ccccc2)C(c2ccccc2)c2c[nH]c3ncccc23)s1)S(=O)(=O)c1ccc2ncsc2c1 |
|
|
|
|
|
|
| 1000080a 0180c800 20500502 c8880e30 002c01c4 0012c030 0080e000 02001880 00500900 000800c0 61300004 48011000 08000802 01a20820 002e0440 000c060c 190e00a8 02000006 01e02400 40203203 40000100 1c008860 278000c0 00400010 40046001 c0000100 0a008080 80050004 0040010a 00460016 61408280 c000a6e2 | 08038012 10803a00 03184108 45b10611 100c12c0 0002c000 04006881 2300d00e 00460980 004918c0 29302a04 f000b880 9e20a832 00c42821 806c24c0 000c160c 18413020 0211008c 00700418 40006e0d c0001900 782a86a0 23900200 db41005c 42043800 ec010104 48000840 d000200c 0c200780 2046000f e0044200 00c107e0 |