On Target PR_HIV1 0.25291827/CHEMBL3645129
For the given ligand Galidesivir triphosphate form, we have found in our database that, being scored 0.25291827, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| Galidesivir triphosphate form (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O)c[nH]c23 | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 1000080a 0180c800 20500502 c8880e30 002c01c4 0012c030 0080e000 02001880 00500900 000800c0 61300004 48011000 08000802 01a20820 002e0440 000c060c 190e00a8 02000006 01e02400 40203203 40000100 1c008860 278000c0 00400010 40046001 c0000100 0a008080 80050004 0040010a 00460016 61408280 c000a6e2 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |