On Target PA_INFA 0.28519857/CHEMBL4463676
For the given ligand Galidesivir triphosphate form, we have found in our database that, being scored 0.28519857, the most similar ligand is CHEMBL4463676. Check out the elaboration below.
| Galidesivir triphosphate form (Given Ligand) | CHEMBL4463676 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O)c[nH]c23 | COCCN1C[C@H](Cc2ccccc2)n2cc(C(=O)O)c(=O)c(O)c2C1=O |
|
|
|
|
|
|
| 1000080a 0180c800 20500502 c8880e30 002c01c4 0012c030 0080e000 02001880 00500900 000800c0 61300004 48011000 08000802 01a20820 002e0440 000c060c 190e00a8 02000006 01e02400 40203203 40000100 1c008860 278000c0 00400010 40046001 c0000100 0a008080 80050004 0040010a 00460016 61408280 c000a6e2 | 0000001a 4880fe08 70104100 50050e10 040410aa 0012c144 0c000000 22203401 02300900 801908d0 08390004 40018000 80009806 08500000 001a1c80 2a0c210c 10004000 82004006 00200000 00060201 c0000121 382f8e50 32802000 c350001c 08152400 c0000080 08c00060 90040001 0c440304 0406005b e40c0000 40004600 |