On Target NS5B_HCV1A 0.21875/CHEMBL353549
For the given ligand Tenofovir, we have found in our database that, being scored 0.21875, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Tenofovir (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| CC(Cn2cnc1c(N)ncnc12)OCP(=O)(O)O | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 0000000a 00901800 80080000 48080620 00080041 0000c100 00008002 00000800 00400108 00000080 0000800c 40019000 00001000 00820000 00081080 300ec00c 00200028 00000000 10400000 80200000 80000080 15400050 23800040 04000014 00000000 00000000 00000200 08014030 00000208 00460000 c0080000 000080c4 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |