On Target RT_HIV1 0.23837209/CHEMBL4288759
For the given ligand Tenofovir, we have found in our database that, being scored 0.23837209, the most similar ligand is CHEMBL4288759. Check out the elaboration below.
| Tenofovir (Given Ligand) | CHEMBL4288759 (Similar Ligand) |
|---|---|
| CC(Cn2cnc1c(N)ncnc12)OCP(=O)(O)O | O=c1nc(Nc2ccc(-c3cnc4ccccc4c3)cc2)c2cccnc2n1O |
|
|
|
|
|
|
| 0000000a 00901800 80080000 48080620 00080041 0000c100 00008002 00000800 00400108 00000080 0000800c 40019000 00001000 00820000 00081080 300ec00c 00200028 00000000 10400000 80200000 80000080 15400050 23800040 04000014 00000000 00000000 00000200 08014030 00000208 00460000 c0080000 000080c4 | 01002002 00c00800 00084100 48090610 00041000 04004108 00009010 40000800 04002100 00000860 04300004 40049000 04008800 00c080c0 003000c0 900c0014 00060040 12014004 0c60000a 10200002 40802000 08078068 30804040 80c00004 00040001 c0080000 2a008280 000000e0 0040c008 00460000 c0040000 800000c0 |