On Target PLP_SARS 0.22142857/CHEMBL358279
For the given ligand 4c, we have found in our database that, being scored 0.22142857, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| 4c (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CC(C)CC(=O)c2c(O)c(Cc1c(O)c(C(=O)CC(C)C)c(O)c(C(=O)CC(C)C)c1O)c(O)c(C(=O)CC(C)C)c2O | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 00000001 01000808 20000103 00010200 00000001 00020000 02800000 01000200 00000800 00080a40 08100000 40009240 04008002 00200000 00000000 08082008 00000000 02000000 00000000 00020801 00000100 08020200 01000020 00400014 00000000 a0000000 00120000 40800000 00000080 00024002 82000000 00000400 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |