On Target NP_HCoV-OC43 0.09565217/CHEMBL3233481
For the given ligand 4c, we have found in our database that, being scored 0.09565217, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| 4c (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)CC(=O)c2c(O)c(Cc1c(O)c(C(=O)CC(C)C)c(O)c(C(=O)CC(C)C)c1O)c(O)c(C(=O)CC(C)C)c2O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000001 01000808 20000103 00010200 00000001 00020000 02800000 01000200 00000800 00080a40 08100000 40009240 04008002 00200000 00000000 08082008 00000000 02000000 00000000 00020801 00000100 08020200 01000020 00400014 00000000 a0000000 00120000 40800000 00000080 00024002 82000000 00000400 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |