On Target RT_HIV1 0.35576922/CHEMBL3775172
For the given ligand 4c, we have found in our database that, being scored 0.35576922, the most similar ligand is CHEMBL3775172. Check out the elaboration below.
| 4c (Given Ligand) | CHEMBL3775172 (Similar Ligand) |
|---|---|
| CC(C)CC(=O)c2c(O)c(Cc1c(O)c(C(=O)CC(C)C)c(O)c(C(=O)CC(C)C)c1O)c(O)c(C(=O)CC(C)C)c2O | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000001 01000808 20000103 00010200 00000001 00020000 02800000 01000200 00000800 00080a40 08100000 40009240 04008002 00200000 00000000 08082008 00000000 02000000 00000000 00020801 00000100 08020200 01000020 00400014 00000000 a0000000 00120000 40800000 00000080 00024002 82000000 00000400 | 00010000 01000800 00000302 40050200 00080000 00004000 80000080 00000402 00000900 00188848 08100000 40009800 04028008 00a00000 00000402 00080008 00000400 02000020 02402000 00000001 01000100 08020a20 01008020 00400014 01200000 80000000 00406000 c0000000 00400002 01020002 e4020000 00000400 |