On Target DPM_HHV1K 0.14741036/CHEMBL479371
For the given ligand Comp3, we have found in our database that, being scored 0.14741036, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| Comp3 (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| O=C(O)c1cc(F)ccc1C#C/C\2=C/C/C=C2 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 08000200 800e0800 00100900 02090200 00402000 0000c011 00000200 00000502 00000100 00102840 01000000 d4008808 80008800 00201000 01000200 40080008 00000000 22008000 00000002 20100000 02001001 08820a20 0000a001 82400815 00000004 80010002 00400000 02c00001 00000002 00028000 c4000800 00000200 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |