On Target NA_INFB 0.18229167/CHEMBL4175983
For the given ligand CHEMBL415, we have found in our database that, being scored 0.18229167, the most similar ligand is CHEMBL4175983. Check out the elaboration below.
| CHEMBL415 (Given Ligand) | CHEMBL4175983 (Similar Ligand) |
|---|---|
| CN(C)CCCN3c1ccccc1CCc2ccc(Cl)cc23 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N3CCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 0000c002 00000000 00100100 01010600 20000000 00000040 08000010 00000040 00002800 00480960 08300004 40008800 02000024 00000001 00020040 00000002 0004c000 02000000 0800000a 00004001 60100100 18100900 20000000 00400010 00002800 80000000 02040008 00001080 00088000 00260012 00000080 20020700 | 00074042 09007800 00100100 84010700 20180080 00002810 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00021448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |