On Target NS5B_HCV1B 0.3110048/CHEMBL3645184
For the given ligand CHEMBL415, we have found in our database that, being scored 0.3110048, the most similar ligand is CHEMBL3645184. Check out the elaboration below.
| CHEMBL415 (Given Ligand) | CHEMBL3645184 (Similar Ligand) |
|---|---|
| CN(C)CCCN3c1ccccc1CCc2ccc(Cl)cc23 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(C)=O)S(C)(=O)=O)cc2nn1-c1ccc(Nc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 0000c002 00000000 00100100 01010600 20000000 00000040 08000010 00000040 00002800 00480960 08300004 40008800 02000024 00000001 00020040 00000002 0004c000 02000000 0800000a 00004001 60100100 18100900 20000000 00400010 00002800 80000000 02040008 00001080 00088000 00260012 00000080 20020700 | 00004006 00805e08 20180902 43390e00 210c0000 00004052 02040010 0200140c 00102900 004909e0 09312024 40118800 80008c23 01401201 808a0040 000e200e 04268000 02000004 0860000a 00225203 e0100101 1c8f8e38 20800800 9360001c 02104080 c0000048 02270080 8000108d 0c488104 0046805b c4048080 a01147e0 |