On Target NS5B_HCV1B 0.23963134/CHEMBL3645183
For the given ligand Phenylpyrazolone2, we have found in our database that, being scored 0.23963134, the most similar ligand is CHEMBL3645183. Check out the elaboration below.
| Phenylpyrazolone2 (Given Ligand) | CHEMBL3645183 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c2ccc(N1/N=C\CC1=O)cc2 | CCN(c1cc2nn(-c3ccc(NCC(C)C)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00826016 00802000 01100000 20b21600 20000010 04000000 00000001 0100401a 00000080 00000841 0029200c 60009000 00008000 00100001 80220040 00004000 00040000 00001000 08000400 00202a00 c0180000 1c000600 70002800 08600018 00000000 08000002 40000000 000000c9 00008000 200e0003 00000000 00010220 | 00004006 00805e08 20180902 41390e00 210c0000 00004042 02040000 0200140c 00100900 000908c0 09312024 40118800 80008c23 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0100101 1c878e38 20800800 8360001c 02104080 c0000040 00270080 8000108c 0c488104 0046004b c4048080 a01147e0 |