On Target NSP1_SARS 0.17535545/CHEMBL221366
For the given ligand Remdesivir triphosphate, we have found in our database that, being scored 0.17535545, the most similar ligand is CHEMBL221366. Check out the elaboration below.
| Remdesivir triphosphate (Given Ligand) | CHEMBL221366 (Similar Ligand) |
|---|---|
| N#CC(O)(c1ccc2c(N)ncnn12)C(O)CO.COP(=O)(O)OP(=O)(O)OP(=O)(O)O | O=C(Oc1cccnc1)c1cccs1 |
|
|
|
|
|
|
| 0000080a 80004008 60403500 18000320 050480e4 8002c024 0380c000 00200a80 10400b00 010c0040 08188004 4a839040 00001802 00920000 00060040 000e200c 09418020 06800004 01600008 00261201 40020100 0c008060 25800cc6 00600010 40000400 80000100 0a0080c0 00050800 0040000c 00c68802 40400280 60208480 | 04010042 04000808 60004108 20000200 00041040 04004084 00080080 00200000 00000100 00000040 00000204 40048080 00808814 08010000 01032000 060c000c 09030000 02002008 00200000 00020010 40002060 48008a80 30900000 10c09004 02002400 04082000 00000200 80000004 00000200 00020000 c0000000 10c10000 |