On Target NA_INFB 0.5168539/CHEMBL370047
For the given ligand Captopril, we have found in our database that, being scored 0.5168539, the most similar ligand is CHEMBL370047. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL370047 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | C/C=C\[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00010000 09003000 00100000 04000400 00080080 00000010 00080000 20000408 10000000 00108088 00200000 40013000 0602801a 01802001 80180400 00080008 10004000 00000040 00402000 00000201 00000000 30040e30 03008001 02100018 00000000 00000000 00404000 90000000 0c000000 00040401 24024000 00002200 |