On Target NS5B_HCV1A 0.29347825/CHEMBL3644906
For the given ligand Laninamivir, we have found in our database that, being scored 0.29347825, the most similar ligand is CHEMBL3644906. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL3644906 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(N3CCOCC3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00014086 0d403400 00101120 85310f00 20080080 00018000 000a0004 a0003409 10800200 00528be8 00242404 5001b000 0e00f002 01042101 80421448 001a8108 12864010 00482000 48610850 00004a01 60100100 bc050e10 33020003 3204003a 02112400 00001002 08000000 902000ac 08008200 81060093 a4184000 01016270 |