On Target RT_HIV1 0.27906978/CHEMBL4224769
For the given ligand Laninamivir, we have found in our database that, being scored 0.27906978, the most similar ligand is CHEMBL4224769. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL4224769 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | C=C(C)[C@@H]1CC[C@]2(CNCCN3CCOCC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00000000 01000800 00100302 c4050600 00000080 00004000 80000080 20000402 00000900 001808c0 08300000 40018800 00028002 00202000 0010140a 00080108 10000400 02000020 02012000 00000201 01000100 38020a30 12008021 02500014 01200400 80000000 00406000 d0000001 08400202 01060002 e4020000 00000600 |