On Target PLP_SARS 0.20858896/CHEMBL213054
For the given ligand Famciclovir, we have found in our database that, being scored 0.20858896, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Famciclovir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC(=O)OCC(CCn2cnc1cnc(N)nc12)COC(C)=O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000000a 00801800 00080100 00010700 00180040 0000c000 0000a000 00000800 00400100 010000c0 0000800c 40019000 00009000 00800000 00080080 100c100c 00020000 00000000 09400000 00200001 80000020 1c000a50 21800840 00400014 00000400 00000000 00000200 00000000 00000208 0046100a c0080000 00000080 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |