On Target NSP15_SARS 0.22292994/CHEMBL2441741
For the given ligand Famciclovir, we have found in our database that, being scored 0.22292994, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Famciclovir (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CC(=O)OCC(CCn2cnc1cnc(N)nc12)COC(C)=O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000000a 00801800 00080100 00010700 00180040 0000c000 0000a000 00000800 00400100 010000c0 0000800c 40019000 00009000 00800000 00080080 100c100c 00020000 00000000 09400000 00200001 80000020 1c000a50 21800840 00400014 00000400 00000000 00000200 00000000 00000208 0046100a c0080000 00000080 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |