On Target NS5B_HCV1B 0.34556574/CHEMBL3645182
For the given ligand Elbasvir, we have found in our database that, being scored 0.34556574, the most similar ligand is CHEMBL3645182. Check out the elaboration below.
| Elbasvir (Given Ligand) | CHEMBL3645182 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c9nc(c2ccc4c(c2)O[C@@H](c3ccccc3)n8c4cc7cc(c6c[nH]c([C@@H]5CCCN5C(=O)[C@@H](NC(=O)OC)C(C)C)n6)ccc78)c[nH]9)C(C)C | CNC(=O)c1c2cc(C3CC3)c(N(CCN3CCOCC3)S(C)(=O)=O)cc2nn1-c1ccc(Oc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 0401e00a 41003208 20100d08 14810e12 20041061 0211c01a 03400400 20083049 84900340 500008d0 80258004 4001b800 0e808882 08712080 01021061 821e210c 00228080 060aa026 04280018 54423a07 40300000 38078e38 b1802001 83d0d019 00144001 c0092002 30000248 100010e8 0c414304 10e60c49 e0145ea0 20002240 | 00004086 00805e08 2018092a c7310e00 010c1080 00004052 02060000 02001408 00100900 00090ac0 09312024 40118800 80008c23 01403201 811a1049 000ea10c 14268000 02000004 08602008 00624201 c0500101 3c838e38 32801800 a360003e 02104480 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |