On Target NS5B_HCV1B 0.2711111/CHEMBL3645211
For the given ligand Famciclovir, we have found in our database that, being scored 0.2711111, the most similar ligand is CHEMBL3645211. Check out the elaboration below.
| Famciclovir (Given Ligand) | CHEMBL3645211 (Similar Ligand) |
|---|---|
| CC(=O)OCC(CCn2cnc1cnc(N)nc12)COC(C)=O | CNC(=O)c1c2cc(C3CC3)c(N(CCC3COC(C)(C)OC3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 0000000a 00801800 00080100 00010700 00180040 0000c000 0000a000 00000800 00400100 010000c0 0000800c 40019000 00009000 00800000 00080080 100c100c 00020000 00000000 09400000 00200001 80000020 1c000a50 21800840 00400014 00000400 00000000 00000200 00000000 00000208 0046100a c0080000 00000080 | 00004006 0480de08 20180902 41310f00 211c0040 00006042 02840800 02001408 00300900 014908e0 09312024 40118800 80008c33 01400201 804a0040 002e300e 04268000 02000004 09608008 00224201 c0100121 1c838e38 2180c800 9360001c 02104480 c0000040 00270280 b400108c 0c488304 0046004b c4248088 a8114ff0 |