On Target NS5B_HCV1A 0.23011364/CHEMBL3644940
For the given ligand Sofosbuvir, we have found in our database that, being scored 0.23011364, the most similar ligand is CHEMBL3644940. Check out the elaboration below.
| Sofosbuvir (Given Ligand) | CHEMBL3644940 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]2O[C@@H](n1ccc(=O)[nH]c1=O)[C@](C)(F)[C@@H]2O)Oc3ccccc3 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2cc(Nc3ccccc3)nc(OC)n2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00200002 01540108 38100910 83010f40 40180074 00084140 02024413 80000020 0f004100 818008f4 0c00100c 4845b168 00009002 03ca0130 00a89080 009c8a8c 002a0030 00008001 29c60000 00025043 a00801a0 1e000a10 27800041 08700010 10040400 c0202002 2f0012a0 10078060 22005281 09460034 55680020 20139684 | 00030486 0d403410 00100120 0d390f00 a0080000 0001c100 000a8814 a0103c09 10802300 00528be8 00302424 7001b050 0e00f102 01042101 a0c20640 001e800c 12865010 10486000 4861085a 10205a01 60120300 be050e10 21824043 3204003a 02192000 00f01102 02000400 902000ac 0a008218 81460093 e4185000 050122f0 |