On Target RT_HIV1 0.31034482/CHEMBL4227119
For the given ligand Famciclovir, we have found in our database that, being scored 0.31034482, the most similar ligand is CHEMBL4227119. Check out the elaboration below.
| Famciclovir (Given Ligand) | CHEMBL4227119 (Similar Ligand) |
|---|---|
| CC(=O)OCC(CCn2cnc1cnc(N)nc12)COC(C)=O | C=C(C)[C@@H]1CC[C@]2(CNCCn3ccnc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 0000000a 00801800 00080100 00010700 00180040 0000c000 0000a000 00000800 00400100 010000c0 0000800c 40019000 00009000 00800000 00080080 100c100c 00020000 00000000 09400000 00200001 80000020 1c000a50 21800840 00400014 00000400 00000000 00000200 00000000 00000208 0046100a c0080000 00000080 | 00000002 01000c00 00100302 40050600 00180040 00004000 80000080 20000402 00200900 001808c0 08309008 40018800 00029002 01200000 00000c82 000c000c 00000400 02000020 02412000 00000201 81000100 38020a30 21008021 02500014 01200000 80000000 00406000 d0000000 08400002 01460012 e40a0000 00000e00 |