On Target NS3_HCV1B 0.45033112/CHEMBL3927196
For the given ligand Ombitasvir, we have found in our database that, being scored 0.45033112, the most similar ligand is CHEMBL3927196. Check out the elaboration below.
| Ombitasvir (Given Ligand) | CHEMBL3927196 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc6ccc([C@@H]4CC[C@@H](c3ccc(NC(=O)[C@@H]2CCCN2C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N4c5ccc(C(C)(C)C)cc5)cc6)C(C)C | CC(C)=CC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 | 00030000 01403400 00100000 04000600 00000000 00018010 00000000 20000408 05800200 00120180 00200000 5001b000 0e02801a 01002011 80000400 001a0008 00020000 00080001 00012810 00000201 00000000 300c0e70 00008003 02100018 00001000 00000002 00404000 90200020 08000200 00040011 a4024000 00802200 |