On Target NS3_HCV1B 0.42088607/CHEMBL1170417
For the given ligand Elbasvir, we have found in our database that, being scored 0.42088607, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Elbasvir (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c9nc(c2ccc4c(c2)O[C@@H](c3ccccc3)n8c4cc7cc(c6c[nH]c([C@@H]5CCCN5C(=O)[C@@H](NC(=O)OC)C(C)C)n6)ccc78)c[nH]9)C(C)C | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 0401e00a 41003208 20100d08 14810e12 20041061 0211c01a 03400400 20083049 84900340 500008d0 80258004 4001b800 0e808882 08712080 01021061 821e210c 00228080 060aa026 04280018 54423a07 40300000 38078e38 b1802001 83d0d019 00144001 c0092002 30000248 100010e8 0c414304 10e60c49 e0145ea0 20002240 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |